Seudónimo Seudónimo

24-10-2020
Mathematics

contestada

How do I put things in standard notation? Please explain :(

How do I put things in standard notation Please explain class=

Respuesta :

felixkings felixkings

24-10-2020

Answer:

[tex]in standard notation \: 9 { \times 10}^{ - 4} = 0.0009[/tex]

Answer Link

Otras preguntas

________ facilitates growth and change in neurons and the migration of neurons to different sites in the brain, all of which are basic processes of early brain

Why do you think it is important to backup your answer with evidence or reasoning?

The division of the diencephalon that houses the pineal gland is the ____________.

A proprietors ownership interest in a sole proprietorship _______ to her heirs through a gift or an estate.

what is the answer in us goverment and citizenship

An electron is accelerated from rest through a potential difference of 240 v. what is the de broglie wavelength of the electron?

According to the safety information in this module the preferred safe method for collecting contaminated broken glass is to?

Gaden company sells a product for $50 per unit. varialbe costs are $40 per unit. calculate the contribution margin per unit, in total, and as a ratio

If a 1.5 v battery stores 6.7 kj of energy (a reasonable value for an inexpensive c cell), for how many minutes could it sustain a current of 1.2 a?

Which skeletal structure corresponds to the condensed structure ch2(oh)ch2chchco2ch(ch3)2?